C22H21F6NO3 — CID 134506945
ethyl (3R,4S)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate (PubChem CID 134506945) has the molecular formula C22H21F6NO3 and a molecular weight of 461.40 g/mol. Its IUPAC name is ethyl (3R,4S)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate.
| Compound Name | ethyl (3R,4S)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134506945 |
| Molecular Formula | C22H21F6NO3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | ethyl (3R,4S)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](c2ccccc2)[C@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C22H21F6NO3/c1-2-32-19(30)29-12-17(14-6-4-3-5-7-14)18(13-29)15-8-10-16(11-9-15)20(31,21(23,24)25)22(26,27)28/h3-11,17-18,31H,2,12-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | KFPSXJSVXTXYFX-MSOLQXFVSA-N |
| XLogP | 5.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |