C24H22F6N2O3 — CID 86670418
benzyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazine-1-carboxylate (PubChem CID 86670418) has the molecular formula C24H22F6N2O3 and a molecular weight of 500.44 g/mol. Its IUPAC name is benzyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86670418 |
| Molecular Formula | C24H22F6N2O3 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | benzyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazine-1-carboxylate |
| SMILES | CC#CC1CN(C(=O)OCc2ccccc2)CCN1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F6N2O3/c1-2-6-20-15-31(21(33)35-16-17-7-4-3-5-8-17)13-14-32(20)19-11-9-18(10-12-19)22(34,23(25,26)27)24(28,29)30/h3-5,7-12,20,34H,13-16H2,1H3 |
| InChIKey | VUOFTMDIYNBEAG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|