C9H11F3N2 — CID 134507065
2,3,5-trifluoro-1-N-propan-2-ylbenzene-1,4-diamine (PubChem CID 134507065) has the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2,3,5-trifluoro-1-N-propan-2-ylbenzene-1,4-diamine.
| Compound Name | 2,3,5-trifluoro-1-N-propan-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 134507065 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2,3,5-trifluoro-1-N-propan-2-ylbenzene-1,4-diamine |
| SMILES | CC(C)Nc1cc(F)c(N)c(F)c1F |
| InChI | InChI=1S/C9H11F3N2/c1-4(2)14-6-3-5(10)9(13)8(12)7(6)11/h3-4,14H,13H2,1-2H3 |
| InChIKey | WTCPQLBRCOMDSF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|