C9H10BrF3N2 — CID 146219796
5-bromo-1-N-(1,1-difluoropropan-2-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 146219796) has the molecular formula C9H10BrF3N2 and a molecular weight of 283.09 g/mol. Its IUPAC name is 5-bromo-1-N-(1,1-difluoropropan-2-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 5-bromo-1-N-(1,1-difluoropropan-2-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 146219796 |
| Molecular Formula | C9H10BrF3N2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 5-bromo-1-N-(1,1-difluoropropan-2-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | CC(Nc1cc(Br)cc(F)c1N)C(F)F |
| InChI | InChI=1S/C9H10BrF3N2/c1-4(9(12)13)15-7-3-5(10)2-6(11)8(7)14/h2-4,9,15H,14H2,1H3 |
| InChIKey | MLXIHADHJOZKOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|