C17H20FN5O — CID 134508455
N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-pyrazol-1-ylbenzenecarboximidamide (PubChem CID 134508455) has the molecular formula C17H20FN5O and a molecular weight of 329.38 g/mol. Its IUPAC name is N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-pyrazol-1-ylbenzenecarboximidamide.
| Compound Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-pyrazol-1-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 134508455 |
| Molecular Formula | C17H20FN5O |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-pyrazol-1-ylbenzenecarboximidamide |
| SMILES | ON/C(=N\[C@H]1CN2CCC1CC2)c1ccc(-n2cccn2)cc1F |
| InChI | InChI=1S/C17H20FN5O/c18-15-10-13(23-7-1-6-19-23)2-3-14(15)17(21-24)20-16-11-22-8-4-12(16)5-9-22/h1-3,6-7,10,12,16,24H,4-5,8-9,11H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | WGTYDUWIJZDDKN-INIZCTEOSA-N |
| XLogP | 1.83 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|