C28H45N5 — CID 134513994
N-ethyl-1-[4-[[3-[1-[4-[(E)-hex-3-en-3-yl]piperazin-1-yl]ethenyl]-4-methylphenyl]methyl]piperazin-1-yl]ethanimine (PubChem CID 134513994) has the molecular formula C28H45N5 and a molecular weight of 451.70 g/mol. Its IUPAC name is N-ethyl-1-[4-[[3-[1-[4-[(E)-hex-3-en-3-yl]piperazin-1-yl]ethenyl]-4-methylphenyl]methyl]piperazin-1-yl]ethanimine.
| Compound Name | N-ethyl-1-[4-[[3-[1-[4-[(E)-hex-3-en-3-yl]piperazin-1-yl]ethenyl]-4-methylphenyl]methyl]piperazin-1-yl]ethanimine |
|---|---|
| PubChem CID | 134513994 |
| Molecular Formula | C28H45N5 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.37 |
| IUPAC Name | N-ethyl-1-[4-[[3-[1-[4-[(E)-hex-3-en-3-yl]piperazin-1-yl]ethenyl]-4-methylphenyl]methyl]piperazin-1-yl]ethanimine |
| SMILES | C=C(c1cc(CN2CCN(/C(C)=N/CC)CC2)ccc1C)N1CCN(/C(=C/CC)CC)CC1 |
| InChI | InChI=1S/C28H45N5/c1-7-10-27(8-2)33-19-17-31(18-20-33)24(5)28-21-26(12-11-23(28)4)22-30-13-15-32(16-14-30)25(6)29-9-3/h10-12,21H,5,7-9,13-20,22H2,1-4,6H3/b27-10+,29-25+ |
| InChIKey | WAPHCJYJJFRDAD-XYJNMOFISA-N |
| XLogP | 4.84 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|