C12H20FNO — CID 134530858
3-[(2Z,4Z)-5-fluoro-6-methylhepta-2,4-dien-4-yl]oxy-1-methylazetidine (PubChem CID 134530858) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-[(2Z,4Z)-5-fluoro-6-methylhepta-2,4-dien-4-yl]oxy-1-methylazetidine.
| Compound Name | 3-[(2Z,4Z)-5-fluoro-6-methylhepta-2,4-dien-4-yl]oxy-1-methylazetidine |
|---|---|
| PubChem CID | 134530858 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-[(2Z,4Z)-5-fluoro-6-methylhepta-2,4-dien-4-yl]oxy-1-methylazetidine |
| SMILES | C/C=C\C(OC1CN(C)C1)=C(\F)C(C)C |
| InChI | InChI=1S/C12H20FNO/c1-5-6-11(12(13)9(2)3)15-10-7-14(4)8-10/h5-6,9-10H,7-8H2,1-4H3/b6-5-,12-11- |
| InChIKey | LLVPNDOTYFTOMO-KSIKAEMPSA-N |
| XLogP | 2.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|