C20H23NO9 — CID 134533317
2-[(4-ethoxycarbonylphenyl)methyl]-5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxyamino]-5-oxopentanoic acid (PubChem CID 134533317) has the molecular formula C20H23NO9 and a molecular weight of 421.40 g/mol. Its IUPAC name is 2-[(4-ethoxycarbonylphenyl)methyl]-5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxyamino]-5-oxopentanoic acid.
| Compound Name | 2-[(4-ethoxycarbonylphenyl)methyl]-5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134533317 |
| Molecular Formula | C20H23NO9 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[(4-ethoxycarbonylphenyl)methyl]-5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxyamino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)c1ccc(CC(CCC(=O)NOCc2oc(=O)oc2C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23NO9/c1-3-27-19(25)14-6-4-13(5-7-14)10-15(18(23)24)8-9-17(22)21-28-11-16-12(2)29-20(26)30-16/h4-7,15H,3,8-11H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | BKLHMTDDGIJUEZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|