C22H23NO8 — CID 134533307
3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-carboxy-5-oxopentyl]benzoic acid (PubChem CID 134533307) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-carboxy-5-oxopentyl]benzoic acid.
| Compound Name | 3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-carboxy-5-oxopentyl]benzoic acid |
|---|---|
| PubChem CID | 134533307 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-carboxy-5-oxopentyl]benzoic acid |
| SMILES | CC(=O)Oc1ccc(CONC(=O)CCC(Cc2cccc(C(=O)O)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H23NO8/c1-14(24)31-19-8-5-15(6-9-19)13-30-23-20(25)10-7-18(22(28)29)12-16-3-2-4-17(11-16)21(26)27/h2-6,8-9,11,18H,7,10,12-13H2,1H3,(H,23,25)(H,26,27)(H,28,29) |
| InChIKey | CBDSVLVJJMCILR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|