C16H19NO6 — CID 134533353
3-[2-formyl-5-oxo-5-(propanoyloxyamino)pentyl]benzoic acid (PubChem CID 134533353) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-[2-formyl-5-oxo-5-(propanoyloxyamino)pentyl]benzoic acid.
| Compound Name | 3-[2-formyl-5-oxo-5-(propanoyloxyamino)pentyl]benzoic acid |
|---|---|
| PubChem CID | 134533353 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-[2-formyl-5-oxo-5-(propanoyloxyamino)pentyl]benzoic acid |
| SMILES | CCC(=O)ONC(=O)CCC(C=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H19NO6/c1-2-15(20)23-17-14(19)7-6-12(10-18)8-11-4-3-5-13(9-11)16(21)22/h3-5,9-10,12H,2,6-8H2,1H3,(H,17,19)(H,21,22) |
| InChIKey | DVOYRRIRMCSGIZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|