C18H23NO6 — CID 170126873
3-[5-(2,2-dimethylpropanoyloxyamino)-2-formyl-5-oxopentyl]benzoic acid (PubChem CID 170126873) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylpropanoyloxyamino)-2-formyl-5-oxopentyl]benzoic acid.
| Compound Name | 3-[5-(2,2-dimethylpropanoyloxyamino)-2-formyl-5-oxopentyl]benzoic acid |
|---|---|
| PubChem CID | 170126873 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-[5-(2,2-dimethylpropanoyloxyamino)-2-formyl-5-oxopentyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)ONC(=O)CCC(C=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H23NO6/c1-18(2,3)17(24)25-19-15(21)8-7-13(11-20)9-12-5-4-6-14(10-12)16(22)23/h4-6,10-11,13H,7-9H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | OJFFJZQPECETDN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|