C25H29NO7 — CID 134523914
3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-5-[(2-phenylacetyl)oxyamino]pentyl]benzoic acid (PubChem CID 134523914) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-5-[(2-phenylacetyl)oxyamino]pentyl]benzoic acid.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-5-[(2-phenylacetyl)oxyamino]pentyl]benzoic acid |
|---|---|
| PubChem CID | 134523914 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-5-[(2-phenylacetyl)oxyamino]pentyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)NOC(=O)Cc1ccccc1)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H29NO7/c1-25(2,3)32-24(31)20(15-18-10-7-11-19(14-18)23(29)30)12-13-21(27)26-33-22(28)16-17-8-5-4-6-9-17/h4-11,14,20H,12-13,15-16H2,1-3H3,(H,26,27)(H,29,30) |
| InChIKey | GMUUCHFOLHGUOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|