C32H37NO6 — CID 146262449
tert-butyl 3-[3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-methyl-5-oxopentyl]phenyl]benzoate (PubChem CID 146262449) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is tert-butyl 3-[3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-methyl-5-oxopentyl]phenyl]benzoate.
| Compound Name | tert-butyl 3-[3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-methyl-5-oxopentyl]phenyl]benzoate |
|---|---|
| PubChem CID | 146262449 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | tert-butyl 3-[3-[5-[(4-acetyloxyphenyl)methoxyamino]-2-methyl-5-oxopentyl]phenyl]benzoate |
| SMILES | CC(=O)Oc1ccc(CONC(=O)CCC(C)Cc2cccc(-c3cccc(C(=O)OC(C)(C)C)c3)c2)cc1 |
| InChI | InChI=1S/C32H37NO6/c1-22(12-17-30(35)33-37-21-24-13-15-29(16-14-24)38-23(2)34)18-25-8-6-9-26(19-25)27-10-7-11-28(20-27)31(36)39-32(3,4)5/h6-11,13-16,19-20,22H,12,17-18,21H2,1-5H3,(H,33,35) |
| InChIKey | NRXUTCWTNILRKX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|