C29H29NO7 — CID 159164134
5-[(4-acetyloxyphenyl)methoxyamino]-2-[[3-(3-acetylphenyl)phenyl]methyl]-5-oxopentanoic acid (PubChem CID 159164134) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is 5-[(4-acetyloxyphenyl)methoxyamino]-2-[[3-(3-acetylphenyl)phenyl]methyl]-5-oxopentanoic acid.
| Compound Name | 5-[(4-acetyloxyphenyl)methoxyamino]-2-[[3-(3-acetylphenyl)phenyl]methyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 159164134 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 5-[(4-acetyloxyphenyl)methoxyamino]-2-[[3-(3-acetylphenyl)phenyl]methyl]-5-oxopentanoic acid |
| SMILES | CC(=O)Oc1ccc(CONC(=O)CCC(Cc2cccc(-c3cccc(C(C)=O)c3)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C29H29NO7/c1-19(31)23-6-4-8-25(17-23)24-7-3-5-22(15-24)16-26(29(34)35)11-14-28(33)30-36-18-21-9-12-27(13-10-21)37-20(2)32/h3-10,12-13,15,17,26H,11,14,16,18H2,1-2H3,(H,30,33)(H,34,35) |
| InChIKey | UCPCNLIZVTYDSB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|