C34H50N2O7 — CID 134533422
tert-butyl 4-[5-[(3,5-dimethyl-1-adamantyl)carbamoyloxyamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopentyl]benzoate (PubChem CID 134533422) has the molecular formula C34H50N2O7 and a molecular weight of 598.78 g/mol. Its IUPAC name is tert-butyl 4-[5-[(3,5-dimethyl-1-adamantyl)carbamoyloxyamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopentyl]benzoate.
| Compound Name | tert-butyl 4-[5-[(3,5-dimethyl-1-adamantyl)carbamoyloxyamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopentyl]benzoate |
|---|---|
| PubChem CID | 134533422 |
| Molecular Formula | C34H50N2O7 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | tert-butyl 4-[5-[(3,5-dimethyl-1-adamantyl)carbamoyloxyamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopentyl]benzoate |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)ONC(=O)CCC(Cc1ccc(C(=O)OC(C)(C)C)cc1)C(=O)OC(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C34H50N2O7/c1-30(2,3)41-27(38)24-11-9-22(10-12-24)15-25(28(39)42-31(4,5)6)13-14-26(37)36-43-29(40)35-34-18-23-16-32(7,20-34)19-33(8,17-23)21-34/h9-12,23,25H,13-21H2,1-8H3,(H,35,40)(H,36,37) |
| InChIKey | LVAXCKPCZPSKTJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|