C10H19NO — CID 134533797
(2S,3R,4Z,6Z)-1-amino-3,5-dimethylocta-4,6-dien-2-ol (PubChem CID 134533797) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,3R,4Z,6Z)-1-amino-3,5-dimethylocta-4,6-dien-2-ol.
| Compound Name | (2S,3R,4Z,6Z)-1-amino-3,5-dimethylocta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 134533797 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,3R,4Z,6Z)-1-amino-3,5-dimethylocta-4,6-dien-2-ol |
| SMILES | C/C=C\C(C)=C/[C@@H](C)[C@H](O)CN |
| InChI | InChI=1S/C10H19NO/c1-4-5-8(2)6-9(3)10(12)7-11/h4-6,9-10,12H,7,11H2,1-3H3/b5-4-,8-6-/t9-,10-/m1/s1 |
| InChIKey | AWSNXUACNREZKG-GUWRLOPCSA-N |
| XLogP | 1.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|