C9H12F3N — CID 134534340
1,5-dimethyl-2-(1,1,2-trifluoroethyl)-2H-pyridine (PubChem CID 134534340) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is 1,5-dimethyl-2-(1,1,2-trifluoroethyl)-2H-pyridine.
| Compound Name | 1,5-dimethyl-2-(1,1,2-trifluoroethyl)-2H-pyridine |
|---|---|
| PubChem CID | 134534340 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1,5-dimethyl-2-(1,1,2-trifluoroethyl)-2H-pyridine |
| SMILES | CC1=CN(C)C(C(F)(F)CF)C=C1 |
| InChI | InChI=1S/C9H12F3N/c1-7-3-4-8(13(2)5-7)9(11,12)6-10/h3-5,8H,6H2,1-2H3 |
| InChIKey | HCFFCFXOSOFWQX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |