C18H37N2O6P — CID 134535350
bis[[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]phosphinic acid (PubChem CID 134535350) has the molecular formula C18H37N2O6P and a molecular weight of 408.48 g/mol. Its IUPAC name is bis[[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]phosphinic acid.
| Compound Name | bis[[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]phosphinic acid |
|---|---|
| PubChem CID | 134535350 |
| Molecular Formula | C18H37N2O6P |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | bis[[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]phosphinic acid |
| SMILES | CC(C)[C@H](NP(=O)(O)N[C@H](C(=O)OC(C)(C)C)C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37N2O6P/c1-11(2)13(15(21)25-17(5,6)7)19-27(23,24)20-14(12(3)4)16(22)26-18(8,9)10/h11-14H,1-10H3,(H3,19,20,23,24)/t13-,14-/m0/s1 |
| InChIKey | ZRFNTRFBUAPRDB-KBPBESRZSA-N |
| XLogP | 3.00 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|