C20H21N5O2 — CID 134535543
N-(2-amino-5-phenylphenyl)-2-piperazin-1-yl-1,3-oxazole-5-carboxamide (PubChem CID 134535543) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-2-piperazin-1-yl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-2-piperazin-1-yl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 134535543 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-2-piperazin-1-yl-1,3-oxazole-5-carboxamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1cnc(N2CCNCC2)o1 |
| InChI | InChI=1S/C20H21N5O2/c21-16-7-6-15(14-4-2-1-3-5-14)12-17(16)24-19(26)18-13-23-20(27-18)25-10-8-22-9-11-25/h1-7,12-13,22H,8-11,21H2,(H,24,26) |
| InChIKey | KNYYUXNZNQLVQF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|