C22H34ClN7O2 — CID 134539331
N-[1-[5-(4-amino-2-butoxy-6-cyano-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pentyl]piperidin-2-yl]formamide;hydrochloride (PubChem CID 134539331) has the molecular formula C22H34ClN7O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is N-[1-[5-(4-amino-2-butoxy-6-cyano-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pentyl]piperidin-2-yl]formamide;hydrochloride.
| Compound Name | N-[1-[5-(4-amino-2-butoxy-6-cyano-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pentyl]piperidin-2-yl]formamide;hydrochloride |
|---|---|
| PubChem CID | 134539331 |
| Molecular Formula | C22H34ClN7O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[1-[5-(4-amino-2-butoxy-6-cyano-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pentyl]piperidin-2-yl]formamide;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(C#N)c(CCCCCN3CCCCC3NC=O)c2n1.Cl |
| InChI | InChI=1S/C22H33N7O2.ClH/c1-2-3-13-31-22-27-19-16(17(14-23)26-20(19)21(24)28-22)9-5-4-7-11-29-12-8-6-10-18(29)25-15-30;/h15,18,26H,2-13H2,1H3,(H,25,30)(H2,24,27,28);1H |
| InChIKey | WPXPSZKXHMHYEL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|