C20H30N6O2 — CID 140874913
4-amino-2-butoxy-7-[3-hydroxy-3-(1-methylpiperidin-4-yl)propyl]-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile (PubChem CID 140874913) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[3-hydroxy-3-(1-methylpiperidin-4-yl)propyl]-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile.
| Compound Name | 4-amino-2-butoxy-7-[3-hydroxy-3-(1-methylpiperidin-4-yl)propyl]-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 140874913 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-amino-2-butoxy-7-[3-hydroxy-3-(1-methylpiperidin-4-yl)propyl]-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile |
| SMILES | CCCCOc1nc(N)c2[nH]c(C#N)c(CCC(O)C3CCN(C)CC3)c2n1 |
| InChI | InChI=1S/C20H30N6O2/c1-3-4-11-28-20-24-17-14(15(12-21)23-18(17)19(22)25-20)5-6-16(27)13-7-9-26(2)10-8-13/h13,16,23,27H,3-11H2,1-2H3,(H2,22,24,25) |
| InChIKey | HNCYDBMPUVHBIU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|