C30H53N7O2 — CID 67184163
6-amino-9-[1,5-bis(1-propylpiperidin-4-yl)pentyl]-2-butoxy-7H-purin-8-one (PubChem CID 67184163) has the molecular formula C30H53N7O2 and a molecular weight of 543.80 g/mol. Its IUPAC name is 6-amino-9-[1,5-bis(1-propylpiperidin-4-yl)pentyl]-2-butoxy-7H-purin-8-one.
| Compound Name | 6-amino-9-[1,5-bis(1-propylpiperidin-4-yl)pentyl]-2-butoxy-7H-purin-8-one |
|---|---|
| PubChem CID | 67184163 |
| Molecular Formula | C30H53N7O2 |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.43 |
| IUPAC Name | 6-amino-9-[1,5-bis(1-propylpiperidin-4-yl)pentyl]-2-butoxy-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(C(CCCCC3CCN(CCC)CC3)C3CCN(CCC)CC3)c2n1 |
| InChI | InChI=1S/C30H53N7O2/c1-4-7-22-39-29-33-27(31)26-28(34-29)37(30(38)32-26)25(24-14-20-36(17-6-3)21-15-24)11-9-8-10-23-12-18-35(16-5-2)19-13-23/h23-25H,4-22H2,1-3H3,(H,32,38)(H2,31,33,34) |
| InChIKey | JSPWNIIOUCZBNW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|