C27H41N7O3 — CID 67445495
6-amino-2-butoxy-9-[4-[methyl(2-phenoxyethyl)amino]-1-piperidin-4-ylbutyl]-7H-purin-8-one (PubChem CID 67445495) has the molecular formula C27H41N7O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[4-[methyl(2-phenoxyethyl)amino]-1-piperidin-4-ylbutyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[4-[methyl(2-phenoxyethyl)amino]-1-piperidin-4-ylbutyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67445495 |
| Molecular Formula | C27H41N7O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | 6-amino-2-butoxy-9-[4-[methyl(2-phenoxyethyl)amino]-1-piperidin-4-ylbutyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(C(CCCN(C)CCOc3ccccc3)C3CCNCC3)c2n1 |
| InChI | InChI=1S/C27H41N7O3/c1-3-4-18-37-26-31-24(28)23-25(32-26)34(27(35)30-23)22(20-12-14-29-15-13-20)11-8-16-33(2)17-19-36-21-9-6-5-7-10-21/h5-7,9-10,20,22,29H,3-4,8,11-19H2,1-2H3,(H,30,35)(H2,28,31,32) |
| InChIKey | XKLVGRXWZDTGCY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|