C21H35N7O — CID 67184215
2-butoxy-9-[1,2-di(piperidin-4-yl)ethyl]purin-6-amine (PubChem CID 67184215) has the molecular formula C21H35N7O and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-butoxy-9-[1,2-di(piperidin-4-yl)ethyl]purin-6-amine.
| Compound Name | 2-butoxy-9-[1,2-di(piperidin-4-yl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 67184215 |
| Molecular Formula | C21H35N7O |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 2-butoxy-9-[1,2-di(piperidin-4-yl)ethyl]purin-6-amine |
| SMILES | CCCCOc1nc(N)c2ncn(C(CC3CCNCC3)C3CCNCC3)c2n1 |
| InChI | InChI=1S/C21H35N7O/c1-2-3-12-29-21-26-19(22)18-20(27-21)28(14-25-18)17(16-6-10-24-11-7-16)13-15-4-8-23-9-5-15/h14-17,23-24H,2-13H2,1H3,(H2,22,26,27) |
| InChIKey | YQCUGKGVKQPXMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|