C20H17FIN5O — CID 134546825
N-(2-amino-4-iodophenyl)-1-[(5-fluoro-3-pyridinyl)methyl]-3a,7a-dihydroindazole-5-carboxamide (PubChem CID 134546825) has the molecular formula C20H17FIN5O and a molecular weight of 489.29 g/mol. Its IUPAC name is N-(2-amino-4-iodophenyl)-1-[(5-fluoro-3-pyridinyl)methyl]-3a,7a-dihydroindazole-5-carboxamide.
| Compound Name | N-(2-amino-4-iodophenyl)-1-[(5-fluoro-3-pyridinyl)methyl]-3a,7a-dihydroindazole-5-carboxamide |
|---|---|
| PubChem CID | 134546825 |
| Molecular Formula | C20H17FIN5O |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-(2-amino-4-iodophenyl)-1-[(5-fluoro-3-pyridinyl)methyl]-3a,7a-dihydroindazole-5-carboxamide |
| SMILES | Nc1cc(I)ccc1NC(=O)C1=CC2C=NN(Cc3cncc(F)c3)C2C=C1 |
| InChI | InChI=1S/C20H17FIN5O/c21-15-5-12(8-24-10-15)11-27-19-4-1-13(6-14(19)9-25-27)20(28)26-18-3-2-16(22)7-17(18)23/h1-10,14,19H,11,23H2,(H,26,28) |
| InChIKey | PECRSTJDAWNQNS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|