C25H24FN5O4 — CID 139538291
[3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxylate (PubChem CID 139538291) has the molecular formula C25H24FN5O4 and a molecular weight of 477.50 g/mol. Its IUPAC name is [3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxylate.
| Compound Name | [3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxylate |
|---|---|
| PubChem CID | 139538291 |
| Molecular Formula | C25H24FN5O4 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OC(=O)c2ccc3c(cnn3Cc3cncc(F)c3)c2)cc1N |
| InChI | InChI=1S/C25H24FN5O4/c1-25(2,3)35-24(33)30-21-6-5-19(10-20(21)27)34-23(32)16-4-7-22-17(9-16)12-29-31(22)14-15-8-18(26)13-28-11-15/h4-13H,14,27H2,1-3H3,(H,30,33) |
| InChIKey | BFAQKEXJJKTRGU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|