C21H18FN5O — CID 135242542
N-(2-amino-4-methylphenyl)-1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxamide (PubChem CID 135242542) has the molecular formula C21H18FN5O and a molecular weight of 375.41 g/mol. Its IUPAC name is N-(2-amino-4-methylphenyl)-1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxamide.
| Compound Name | N-(2-amino-4-methylphenyl)-1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 135242542 |
| Molecular Formula | C21H18FN5O |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(2-amino-4-methylphenyl)-1-[(5-fluoro-3-pyridinyl)methyl]indazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(cnn3Cc3cncc(F)c3)c2)c(N)c1 |
| InChI | InChI=1S/C21H18FN5O/c1-13-2-4-19(18(23)6-13)26-21(28)15-3-5-20-16(8-15)10-25-27(20)12-14-7-17(22)11-24-9-14/h2-11H,12,23H2,1H3,(H,26,28) |
| InChIKey | HICTXCLENMLYTG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|