C13H19F3N2 — CID 134549736
(2E)-2-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1-N'-(trifluoromethyl)hexa-2,4-diene-1,1-diamine (PubChem CID 134549736) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (2E)-2-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1-N'-(trifluoromethyl)hexa-2,4-diene-1,1-diamine.
| Compound Name | (2E)-2-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1-N'-(trifluoromethyl)hexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 134549736 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2E)-2-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1-N'-(trifluoromethyl)hexa-2,4-diene-1,1-diamine |
| SMILES | C=C(C)/C(C)=C/C(=C\C=CC)C(N)NC(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-5-6-7-11(8-10(4)9(2)3)12(17)18-13(14,15)16/h5-8,12,18H,2,17H2,1,3-4H3/b6-5?,10-8+,11-7+ |
| InChIKey | DAYGJKYUCNBYHL-DWAPDOARSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|