About ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate
ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate (PubChem CID 134557152) has the molecular formula C19H34O3
and a molecular weight of 310.48 g/mol. Its IUPAC name is ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate |
| PubChem CID | 134557152 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate |
| SMILES | CCCCCCCCCC(C)/C(C)=C(/C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H34O3/c1-6-8-9-10-11-12-13-14-15(3)16(4)18(17(5)20)19(21)22-7-2/h15H,6-14H2,1-5H3/b18-16- |
| InChIKey | NXTNWOADHYMELI-VLGSPTGOSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate?
The IUPAC name of ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate (CID 134557152) is ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate.
What is the SMILES notation for ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate?
The canonical SMILES for ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate is CCCCCCCCCC(C)/C(C)=C(/C(C)=O)C(=O)OCC.
What is the InChIKey of ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate?
The InChIKey is NXTNWOADHYMELI-VLGSPTGOSA-N. The full InChI is InChI=1S/C19H34O3/c1-6-8-9-10-11-12-13-14-15(3)16(4)18(17(5)20)19(21)22-7-2/h15H,6-14H2,1-5H3/b18-16-.
What are the key properties of ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate?
ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate has a molecular weight of 310.48 g/mol, XLogP of 5.23, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-2-acetyl-3,4-dimethyltridec-2-enoate is sourced from PubChem (CID 134557152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).