C16H13F6N5O3S — CID 134557848
[2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-4,5,6,7-tetrahydroindazol-3-yl] trifluoromethanesulfonate (PubChem CID 134557848) has the molecular formula C16H13F6N5O3S and a molecular weight of 469.37 g/mol. Its IUPAC name is [2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-4,5,6,7-tetrahydroindazol-3-yl] trifluoromethanesulfonate.
| Compound Name | [2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-4,5,6,7-tetrahydroindazol-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134557848 |
| Molecular Formula | C16H13F6N5O3S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-4,5,6,7-tetrahydroindazol-3-yl] trifluoromethanesulfonate |
| SMILES | Cn1c(-n2nc3c(c2OS(=O)(=O)C(F)(F)F)CCCC3)nc2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C16H13F6N5O3S/c1-26-12-11(6-8(7-23-12)15(17,18)19)24-14(26)27-13(30-31(28,29)16(20,21)22)9-4-2-3-5-10(9)25-27/h6-7H,2-5H2,1H3 |
| InChIKey | FSKDRWFEAVUBBA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|