C20H27N — CID 134561466
N-(2,5-dimethylphenyl)-N,2,3,4,5,6-hexamethylaniline (PubChem CID 134561466) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N,2,3,4,5,6-hexamethylaniline.
| Compound Name | N-(2,5-dimethylphenyl)-N,2,3,4,5,6-hexamethylaniline |
|---|---|
| PubChem CID | 134561466 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N,2,3,4,5,6-hexamethylaniline |
| SMILES | Cc1ccc(C)c(N(C)c2c(C)c(C)c(C)c(C)c2C)c1 |
| InChI | InChI=1S/C20H27N/c1-12-9-10-13(2)19(11-12)21(8)20-17(6)15(4)14(3)16(5)18(20)7/h9-11H,1-8H3 |
| InChIKey | OKIQYGGBKLLQIN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |