About N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline
N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline (PubChem CID 164803656) has the molecular formula C24H27N
and a molecular weight of 329.49 g/mol. Its IUPAC name is N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline |
| PubChem CID | 164803656 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline |
| SMILES | Cc1ccc(C)c(N(c2cc(C)ccc2C)c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C24H27N/c1-16-10-12-18(3)22(14-16)25(23-15-17(2)11-13-19(23)4)24-20(5)8-7-9-21(24)6/h7-15H,1-6H3 |
| InChIKey | NWQOCPIEMXLZPV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline?
The IUPAC name of N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline (CID 164803656) is N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline.
What is the SMILES notation for N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline?
The canonical SMILES for N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline is Cc1ccc(C)c(N(c2cc(C)ccc2C)c2c(C)cccc2C)c1.
What is the InChIKey of N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline?
The InChIKey is NWQOCPIEMXLZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N/c1-16-10-12-18(3)22(14-16)25(23-15-17(2)11-13-19(23)4)24-20(5)8-7-9-21(24)6/h7-15H,1-6H3.
What are the key properties of N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline?
N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline has a molecular weight of 329.49 g/mol, XLogP of 7.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline is sourced from PubChem (CID 164803656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).