C24H27N — CID 164803656
N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline (PubChem CID 164803656) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline.
| Compound Name | N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 164803656 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N,N-bis(2,5-dimethylphenyl)-2,6-dimethylaniline |
| SMILES | Cc1ccc(C)c(N(c2cc(C)ccc2C)c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C24H27N/c1-16-10-12-18(3)22(14-16)25(23-15-17(2)11-13-19(23)4)24-20(5)8-7-9-21(24)6/h7-15H,1-6H3 |
| InChIKey | NWQOCPIEMXLZPV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |