About 1-amino-1-(2,5-dimethylphenyl)thiourea
1-amino-1-(2,5-dimethylphenyl)thiourea (PubChem CID 20847893) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-amino-1-(2,5-dimethylphenyl)thiourea.
Molecular Properties
| Compound Name | 1-amino-1-(2,5-dimethylphenyl)thiourea |
| PubChem CID | 20847893 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-amino-1-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(N(N)C(N)=S)c1 |
| InChI | InChI=1S/C9H13N3S/c1-6-3-4-7(2)8(5-6)12(11)9(10)13/h3-5H,11H2,1-2H3,(H2,10,13) |
| InChIKey | BRMHFSMSSRDZFW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-(2,5-dimethylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-(2,5-dimethylphenyl)thiourea?
The IUPAC name of 1-amino-1-(2,5-dimethylphenyl)thiourea (CID 20847893) is 1-amino-1-(2,5-dimethylphenyl)thiourea.
What is the SMILES notation for 1-amino-1-(2,5-dimethylphenyl)thiourea?
The canonical SMILES for 1-amino-1-(2,5-dimethylphenyl)thiourea is Cc1ccc(C)c(N(N)C(N)=S)c1.
What is the InChIKey of 1-amino-1-(2,5-dimethylphenyl)thiourea?
The InChIKey is BRMHFSMSSRDZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S/c1-6-3-4-7(2)8(5-6)12(11)9(10)13/h3-5H,11H2,1-2H3,(H2,10,13).
What are the key properties of 1-amino-1-(2,5-dimethylphenyl)thiourea?
1-amino-1-(2,5-dimethylphenyl)thiourea has a molecular weight of 195.29 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-(2,5-dimethylphenyl)thiourea is sourced from PubChem (CID 20847893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).