C12H11N3O4 — CID 134561972
6-[2-(4-nitrophenyl)ethyl]-1,2-dihydropyridazine-3,4-dione (PubChem CID 134561972) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 6-[2-(4-nitrophenyl)ethyl]-1,2-dihydropyridazine-3,4-dione.
| Compound Name | 6-[2-(4-nitrophenyl)ethyl]-1,2-dihydropyridazine-3,4-dione |
|---|---|
| PubChem CID | 134561972 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 6-[2-(4-nitrophenyl)ethyl]-1,2-dihydropyridazine-3,4-dione |
| SMILES | O=c1cc(CCc2ccc([N+](=O)[O-])cc2)[nH][nH]c1=O |
| InChI | InChI=1S/C12H11N3O4/c16-11-7-9(13-14-12(11)17)4-1-8-2-5-10(6-3-8)15(18)19/h2-3,5-7H,1,4H2,(H,13,16)(H,14,17) |
| InChIKey | GBLKGGNVRATJAB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|