C14H16N2O2S — CID 134562755
4,5,6,7-tetramethyl-2-benzothiophene-1,3-dicarboxamide (PubChem CID 134562755) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-2-benzothiophene-1,3-dicarboxamide.
| Compound Name | 4,5,6,7-tetramethyl-2-benzothiophene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 134562755 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4,5,6,7-tetramethyl-2-benzothiophene-1,3-dicarboxamide |
| SMILES | Cc1c(C)c(C)c2c(C(N)=O)sc(C(N)=O)c2c1C |
| InChI | InChI=1S/C14H16N2O2S/c1-5-6(2)8(4)10-9(7(5)3)11(13(15)17)19-12(10)14(16)18/h1-4H3,(H2,15,17)(H2,16,18) |
| InChIKey | HFVBOLXHKSKUNN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |