C20H24IN3O — CID 134567056
2-amino-5-[(2-ethyl-2-phenylbutyl)carbamoyl]benzenecarboximidoyl iodide (PubChem CID 134567056) has the molecular formula C20H24IN3O and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-amino-5-[(2-ethyl-2-phenylbutyl)carbamoyl]benzenecarboximidoyl iodide.
| Compound Name | 2-amino-5-[(2-ethyl-2-phenylbutyl)carbamoyl]benzenecarboximidoyl iodide |
|---|---|
| PubChem CID | 134567056 |
| Molecular Formula | C20H24IN3O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-amino-5-[(2-ethyl-2-phenylbutyl)carbamoyl]benzenecarboximidoyl iodide |
| SMILES | [H]/N=C(\I)c1cc(C(=O)NCC(CC)(CC)c2ccccc2)ccc1N |
| InChI | InChI=1S/C20H24IN3O/c1-3-20(4-2,15-8-6-5-7-9-15)13-24-19(25)14-10-11-17(22)16(12-14)18(21)23/h5-12,23H,3-4,13,22H2,1-2H3,(H,24,25)/b23-18- |
| InChIKey | ZPXHFDOKPIBJSS-NKFKGCMQSA-N |
| XLogP | 4.52 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|