C33H42N4O3 — CID 134567428
4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide (PubChem CID 134567428) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567428 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(CCO)CC2)cc1)c1cc(C(=O)NCC(CC)(CC)c2ccccc2)ccc1N |
| InChI | InChI=1S/C33H42N4O3/c1-3-33(4-2,26-8-6-5-7-9-26)23-36-32(39)25-12-15-30(34)29(22-25)31(35)24-10-13-27(14-11-24)40-28-16-18-37(19-17-28)20-21-38/h5-15,22,28,35,38H,3-4,16-21,23,34H2,1-2H3,(H,36,39)/b35-31+ |
| InChIKey | WPDOSSNMACRAKL-JSLDZMDGSA-N |
| XLogP | 5.01 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|