C27H30N4O2 — CID 134567100
4-amino-N-benzyl-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide (PubChem CID 134567100) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-amino-N-benzyl-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-benzyl-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567100 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-amino-N-benzyl-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C)CC2)cc1)c1cc(C(=O)NCc2ccccc2)ccc1N |
| InChI | InChI=1S/C27H30N4O2/c1-31-15-13-23(14-16-31)33-22-10-7-20(8-11-22)26(29)24-17-21(9-12-25(24)28)27(32)30-18-19-5-3-2-4-6-19/h2-12,17,23,29H,13-16,18,28H2,1H3,(H,30,32)/b29-26+ |
| InChIKey | JZWPVVYVEZBSGU-PBBVDAKRSA-N |
| XLogP | 4.09 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|