C34H42N4O3 — CID 123660318
4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(oxetan-3-yl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide (PubChem CID 123660318) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(oxetan-3-yl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(oxetan-3-yl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 123660318 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 4-amino-N-(2-ethyl-2-phenylbutyl)-3-[4-[1-(oxetan-3-yl)piperidin-4-yl]oxybenzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C3COC3)CC2)cc1)c1cc(C(=O)NCC(CC)(CC)c2ccccc2)ccc1N |
| InChI | InChI=1S/C34H42N4O3/c1-3-34(4-2,26-8-6-5-7-9-26)23-37-33(39)25-12-15-31(35)30(20-25)32(36)24-10-13-28(14-11-24)41-29-16-18-38(19-17-29)27-21-40-22-27/h5-15,20,27,29,36H,3-4,16-19,21-23,35H2,1-2H3,(H,37,39)/b36-32+ |
| InChIKey | GPKGMKJUMCYIEY-WIKZRCHHSA-N |
| XLogP | 5.41 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|