C28H33N5O3 — CID 144602636
4-amino-3-[4-[3-(2-hydroxypropyl)-5-methylmorpholin-4-yl]benzenecarboximidoyl]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 144602636) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-amino-3-[4-[3-(2-hydroxypropyl)-5-methylmorpholin-4-yl]benzenecarboximidoyl]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-amino-3-[4-[3-(2-hydroxypropyl)-5-methylmorpholin-4-yl]benzenecarboximidoyl]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 144602636 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 4-amino-3-[4-[3-(2-hydroxypropyl)-5-methylmorpholin-4-yl]benzenecarboximidoyl]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | [H]/N=C(\c1ccc(N2C(C)COCC2CC(C)O)cc1)c1cc(C(=O)NCc2ccccn2)ccc1N |
| InChI | InChI=1S/C28H33N5O3/c1-18-16-36-17-24(13-19(2)34)33(18)23-9-6-20(7-10-23)27(30)25-14-21(8-11-26(25)29)28(35)32-15-22-5-3-4-12-31-22/h3-12,14,18-19,24,30,34H,13,15-17,29H2,1-2H3,(H,32,35)/b30-27+ |
| InChIKey | NVOFNBBPSJHXER-KDJFERLWSA-N |
| XLogP | 3.37 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|