C34H44ClN4OP — CID 134567319
4-amino-N-[1-(2-chlorophenyl)-2-methylpropyl]-3-[4-(2-methyl-4-methylphosphanyl-6-propylpiperidin-1-yl)benzenecarboximidoyl]benzamide (PubChem CID 134567319) has the molecular formula C34H44ClN4OP and a molecular weight of 591.18 g/mol. Its IUPAC name is 4-amino-N-[1-(2-chlorophenyl)-2-methylpropyl]-3-[4-(2-methyl-4-methylphosphanyl-6-propylpiperidin-1-yl)benzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-[1-(2-chlorophenyl)-2-methylpropyl]-3-[4-(2-methyl-4-methylphosphanyl-6-propylpiperidin-1-yl)benzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567319 |
| Molecular Formula | C34H44ClN4OP |
| Molecular Weight | 591.18 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 4-amino-N-[1-(2-chlorophenyl)-2-methylpropyl]-3-[4-(2-methyl-4-methylphosphanyl-6-propylpiperidin-1-yl)benzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(N2C(C)CC(PC)CC2CCC)cc1)c1cc(C(=O)NC(c2ccccc2Cl)C(C)C)ccc1N |
| InChI | InChI=1S/C34H44ClN4OP/c1-6-9-26-20-27(41-5)18-22(4)39(26)25-15-12-23(13-16-25)32(37)29-19-24(14-17-31(29)36)34(40)38-33(21(2)3)28-10-7-8-11-30(28)35/h7-8,10-17,19,21-22,26-27,33,37,41H,6,9,18,20,36H2,1-5H3,(H,38,40)/b37-32+ |
| InChIKey | CUQDEECHTGAZJX-BQNXFWFHSA-N |
| XLogP | 8.30 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.18 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|