C36H42FN3O2 — CID 134567297
4-amino-N-[(1S)-1-(2-fluorophenyl)-3-methylbutyl]-3-[4-[2-(9-hydroxy-5-tricyclo[5.2.0.01,4]nonanyl)ethyl]benzenecarboximidoyl]benzamide (PubChem CID 134567297) has the molecular formula C36H42FN3O2 and a molecular weight of 567.75 g/mol. Its IUPAC name is 4-amino-N-[(1S)-1-(2-fluorophenyl)-3-methylbutyl]-3-[4-[2-(9-hydroxy-5-tricyclo[5.2.0.01,4]nonanyl)ethyl]benzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-[(1S)-1-(2-fluorophenyl)-3-methylbutyl]-3-[4-[2-(9-hydroxy-5-tricyclo[5.2.0.01,4]nonanyl)ethyl]benzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567297 |
| Molecular Formula | C36H42FN3O2 |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | 4-amino-N-[(1S)-1-(2-fluorophenyl)-3-methylbutyl]-3-[4-[2-(9-hydroxy-5-tricyclo[5.2.0.01,4]nonanyl)ethyl]benzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(CCC2CC3CC(O)C34CCC24)cc1)c1cc(C(=O)N[C@@H](CC(C)C)c2ccccc2F)ccc1N |
| InChI | InChI=1S/C36H42FN3O2/c1-21(2)17-32(27-5-3-4-6-30(27)37)40-35(42)25-13-14-31(38)28(19-25)34(39)23-10-7-22(8-11-23)9-12-24-18-26-20-33(41)36(26)16-15-29(24)36/h3-8,10-11,13-14,19,21,24,26,29,32-33,39,41H,9,12,15-18,20,38H2,1-2H3,(H,40,42)/b39-34-/t24?,26?,29?,32-,33?,36?/m0/s1 |
| InChIKey | IIDCJORVAXVQIM-KDLZJHFUSA-N |
| XLogP | 7.07 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|