C26H29N5O — CID 88875593
4-amino-N-(5-benzyl-1-methylpiperidin-3-yl)-3-(pyridine-4-carboximidoyl)benzamide (PubChem CID 88875593) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-amino-N-(5-benzyl-1-methylpiperidin-3-yl)-3-(pyridine-4-carboximidoyl)benzamide.
| Compound Name | 4-amino-N-(5-benzyl-1-methylpiperidin-3-yl)-3-(pyridine-4-carboximidoyl)benzamide |
|---|---|
| PubChem CID | 88875593 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 4-amino-N-(5-benzyl-1-methylpiperidin-3-yl)-3-(pyridine-4-carboximidoyl)benzamide |
| SMILES | [H]/N=C(\c1ccncc1)c1cc(C(=O)NC2CC(Cc3ccccc3)CN(C)C2)ccc1N |
| InChI | InChI=1S/C26H29N5O/c1-31-16-19(13-18-5-3-2-4-6-18)14-22(17-31)30-26(32)21-7-8-24(27)23(15-21)25(28)20-9-11-29-12-10-20/h2-12,15,19,22,28H,13-14,16-17,27H2,1H3,(H,30,32)/b28-25+ |
| InChIKey | PXXCFKYWJRAKNT-AZPGRJICSA-N |
| XLogP | 3.37 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|