C31H34N4O3 — CID 134567414
4-amino-N-benzyl-3-[4-[[8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzenecarboximidoyl]benzamide (PubChem CID 134567414) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-amino-N-benzyl-3-[4-[[8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-benzyl-3-[4-[[8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567414 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 4-amino-N-benzyl-3-[4-[[8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(OC2CC3CCC(C2)N3C2COC2)cc1)c1cc(C(=O)NCc2ccccc2)ccc1N |
| InChI | InChI=1S/C31H34N4O3/c32-29-13-8-22(31(36)34-17-20-4-2-1-3-5-20)14-28(29)30(33)21-6-11-26(12-7-21)38-27-15-23-9-10-24(16-27)35(23)25-18-37-19-25/h1-8,11-14,23-25,27,33H,9-10,15-19,32H2,(H,34,36)/b33-30- |
| InChIKey | OYYXEOMFLIBBBU-MEIHLTSWSA-N |
| XLogP | 4.39 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|