C30H35N5O2 — CID 134567109
4-amino-N-[cyclobutyl(pyridin-2-yl)methyl]-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide (PubChem CID 134567109) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-amino-N-[cyclobutyl(pyridin-2-yl)methyl]-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide.
| Compound Name | 4-amino-N-[cyclobutyl(pyridin-2-yl)methyl]-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide |
|---|---|
| PubChem CID | 134567109 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 4-amino-N-[cyclobutyl(pyridin-2-yl)methyl]-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C)CC2)cc1)c1cc(C(=O)NC(c2ccccn2)C2CCC2)ccc1N |
| InChI | InChI=1S/C30H35N5O2/c1-35-17-14-24(15-18-35)37-23-11-8-20(9-12-23)28(32)25-19-22(10-13-26(25)31)30(36)34-29(21-5-4-6-21)27-7-2-3-16-33-27/h2-3,7-13,16,19,21,24,29,32H,4-6,14-15,17-18,31H2,1H3,(H,34,36)/b32-28+ |
| InChIKey | AWDKEJSASHNNQC-VEWQFJOQSA-N |
| XLogP | 4.82 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|