C26H28ClN5O2 — CID 134567191
1-[4-amino-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]phenyl]-3-(2-chlorophenyl)urea (PubChem CID 134567191) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 1-[4-amino-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]phenyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[4-amino-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]phenyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 134567191 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[4-amino-3-[4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]phenyl]-3-(2-chlorophenyl)urea |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C)CC2)cc1)c1cc(NC(=O)Nc2ccccc2Cl)ccc1N |
| InChI | InChI=1S/C26H28ClN5O2/c1-32-14-12-20(13-15-32)34-19-9-6-17(7-10-19)25(29)21-16-18(8-11-23(21)28)30-26(33)31-24-5-3-2-4-22(24)27/h2-11,16,20,29H,12-15,28H2,1H3,(H2,30,31,33)/b29-25+ |
| InChIKey | DPWIYRNILODMOQ-XLVZBRSZSA-N |
| XLogP | 5.46 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|