C20H22ClN3O2 — CID 134567323
4-amino-3-[3-chloro-4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzaldehyde (PubChem CID 134567323) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-amino-3-[3-chloro-4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzaldehyde.
| Compound Name | 4-amino-3-[3-chloro-4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzaldehyde |
|---|---|
| PubChem CID | 134567323 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-amino-3-[3-chloro-4-(1-methylpiperidin-4-yl)oxybenzenecarboximidoyl]benzaldehyde |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C)CC2)c(Cl)c1)c1cc(C=O)ccc1N |
| InChI | InChI=1S/C20H22ClN3O2/c1-24-8-6-15(7-9-24)26-19-5-3-14(11-17(19)21)20(23)16-10-13(12-25)2-4-18(16)22/h2-5,10-12,15,23H,6-9,22H2,1H3/b23-20+ |
| InChIKey | CXJPLJADYBXWDL-BSYVCWPDSA-N |
| XLogP | 3.62 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|