C33H41N5O4S — CID 134567014
tert-butyl 4-[4-[2-amino-5-[(2-pyrrolidin-1-yl-2-thiophen-3-ylacetyl)amino]benzenecarboximidoyl]phenoxy]piperidine-1-carboxylate (PubChem CID 134567014) has the molecular formula C33H41N5O4S and a molecular weight of 603.79 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-amino-5-[(2-pyrrolidin-1-yl-2-thiophen-3-ylacetyl)amino]benzenecarboximidoyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-amino-5-[(2-pyrrolidin-1-yl-2-thiophen-3-ylacetyl)amino]benzenecarboximidoyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134567014 |
| Molecular Formula | C33H41N5O4S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | tert-butyl 4-[4-[2-amino-5-[(2-pyrrolidin-1-yl-2-thiophen-3-ylacetyl)amino]benzenecarboximidoyl]phenoxy]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)cc1)c1cc(NC(=O)C(c2ccsc2)N2CCCC2)ccc1N |
| InChI | InChI=1S/C33H41N5O4S/c1-33(2,3)42-32(40)38-17-12-26(13-18-38)41-25-9-6-22(7-10-25)29(35)27-20-24(8-11-28(27)34)36-31(39)30(23-14-19-43-21-23)37-15-4-5-16-37/h6-11,14,19-21,26,30,35H,4-5,12-13,15-18,34H2,1-3H3,(H,36,39)/b35-29+ |
| InChIKey | WUBXNBFXGHERAS-OZMGXUMRSA-N |
| XLogP | 6.30 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|