C30H34N4O2 — CID 134567194
1-[4-[4-[2-amino-5-[1-(benzylamino)ethenyl]benzenecarboximidoyl]phenoxy]piperidin-1-yl]propan-1-one (PubChem CID 134567194) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[4-[4-[2-amino-5-[1-(benzylamino)ethenyl]benzenecarboximidoyl]phenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-[2-amino-5-[1-(benzylamino)ethenyl]benzenecarboximidoyl]phenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 134567194 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 1-[4-[4-[2-amino-5-[1-(benzylamino)ethenyl]benzenecarboximidoyl]phenoxy]piperidin-1-yl]propan-1-one |
| SMILES | [H]/N=C(\c1ccc(OC2CCN(C(=O)CC)CC2)cc1)c1cc(C(=C)NCc2ccccc2)ccc1N |
| InChI | InChI=1S/C30H34N4O2/c1-3-29(35)34-17-15-26(16-18-34)36-25-12-9-23(10-13-25)30(32)27-19-24(11-14-28(27)31)21(2)33-20-22-7-5-4-6-8-22/h4-14,19,26,32-33H,2-3,15-18,20,31H2,1H3/b32-30+ |
| InChIKey | RUVWNKLEYXJDQH-NHQGMKOOSA-N |
| XLogP | 5.23 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|