C23H22FN3O2 — CID 146208991
3-(4-amino-3-methanimidoylphenyl)-N-[1-(2-fluorophenyl)-3-hydroxypropyl]benzamide (PubChem CID 146208991) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-(4-amino-3-methanimidoylphenyl)-N-[1-(2-fluorophenyl)-3-hydroxypropyl]benzamide.
| Compound Name | 3-(4-amino-3-methanimidoylphenyl)-N-[1-(2-fluorophenyl)-3-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 146208991 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 3-(4-amino-3-methanimidoylphenyl)-N-[1-(2-fluorophenyl)-3-hydroxypropyl]benzamide |
| SMILES | [H]/N=C/c1cc(-c2cccc(C(=O)NC(CCO)c3ccccc3F)c2)ccc1N |
| InChI | InChI=1S/C23H22FN3O2/c24-20-7-2-1-6-19(20)22(10-11-28)27-23(29)17-5-3-4-15(12-17)16-8-9-21(26)18(13-16)14-25/h1-9,12-14,22,25,28H,10-11,26H2,(H,27,29)/b25-14+ |
| InChIKey | OJHGFFIUGXRPIO-AFUMVMLFSA-N |
| XLogP | 3.93 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|